C11H14N4O — CID 87829261
(NZ)-N-[[5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 87829261) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is (NZ)-N-[[5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87829261 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (NZ)-N-[[5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1cncc(N2C[C@@H]3C[C@H]2CN3)c1 |
| InChI | InChI=1S/C11H14N4O/c16-14-4-8-1-10(5-12-3-8)15-7-9-2-11(15)6-13-9/h1,3-5,9,11,13,16H,2,6-7H2/b14-4-/t9-,11-/m0/s1 |
| InChIKey | XMEZWSVVQPFXDJ-SOKHGFTGSA-N |
| XLogP | 0.44 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|