C17H25NO10 — CID 87829394
[(2R,3R,4R,5S)-3,4-diacetyl-2,3,4-trihydroxy-6,7-dioxo-5-(propanoylamino)octyl] acetate (PubChem CID 87829394) has the molecular formula C17H25NO10 and a molecular weight of 403.38 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diacetyl-2,3,4-trihydroxy-6,7-dioxo-5-(propanoylamino)octyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-diacetyl-2,3,4-trihydroxy-6,7-dioxo-5-(propanoylamino)octyl] acetate |
|---|---|
| PubChem CID | 87829394 |
| Molecular Formula | C17H25NO10 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diacetyl-2,3,4-trihydroxy-6,7-dioxo-5-(propanoylamino)octyl] acetate |
| SMILES | CCC(=O)N[C@H](C(=O)C(C)=O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@H](O)COC(C)=O |
| InChI | InChI=1S/C17H25NO10/c1-6-13(24)18-15(14(25)8(2)19)17(27,10(4)21)16(26,9(3)20)12(23)7-28-11(5)22/h12,15,23,26-27H,6-7H2,1-5H3,(H,18,24)/t12-,15-,16-,17-/m1/s1 |
| InChIKey | PGMARESZYDGDHN-BASLNEPJSA-N |
| XLogP | -2.40 |
| TPSA | 184.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|