About 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+)
9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) (PubChem CID 87829494) has the molecular formula C29H23PZr
and a molecular weight of 493.70 g/mol. Its IUPAC name is 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+).
Molecular Properties
| Compound Name | 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) |
| PubChem CID | 87829494 |
| Molecular Formula | C29H23PZr |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) |
| SMILES | Cc1ccccc1Pc1cc2ccccc2[cH-]1.[Zr+2].c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C16H14P.C13H9.Zr/c1-12-6-2-5-9-16(12)17-15-10-13-7-3-4-8-14(13)11-15;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h2-11,17H,1H3;1-9H;/q2*-1;+2 |
| InChIKey | QCGFDMTVCYYRQC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+)?
The IUPAC name of 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) (CID 87829494) is 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+).
What is the SMILES notation for 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+)?
The canonical SMILES for 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) is Cc1ccccc1Pc1cc2ccccc2[cH-]1.[Zr+2].c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+)?
The InChIKey is QCGFDMTVCYYRQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14P.C13H9.Zr/c1-12-6-2-5-9-16(12)17-15-10-13-7-3-4-8-14(13)11-15;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h2-11,17H,1H3;1-9H;/q2*-1;+2.
What are the key properties of 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+)?
9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) has a molecular weight of 493.70 g/mol, XLogP of 7.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ide;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane;zirconium(2+) is sourced from PubChem (CID 87829494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).