About [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate
[(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate (PubChem CID 87830167) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate |
| PubChem CID | 87830167 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate |
| SMILES | CC1CCC(NOC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H23NO2/c1-9-5-7-10(8-6-9)13-15-11(14)12(2,3)4/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | XPFZNJURZSAEIA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate?
The IUPAC name of [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate (CID 87830167) is [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate.
What is the SMILES notation for [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate?
The canonical SMILES for [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate is CC1CCC(NOC(=O)C(C)(C)C)CC1.
What is the InChIKey of [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate?
The InChIKey is XPFZNJURZSAEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-9-5-7-10(8-6-9)13-15-11(14)12(2,3)4/h9-10,13H,5-8H2,1-4H3.
What are the key properties of [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate?
[(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate has a molecular weight of 213.32 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methylcyclohexyl)amino] 2,2-dimethylpropanoate is sourced from PubChem (CID 87830167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).