C25H25PZr — CID 87830426
2,3,3a,4-tetrahydro-1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) (PubChem CID 87830426) has the molecular formula C25H25PZr and a molecular weight of 447.67 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+).
| Compound Name | 2,3,3a,4-tetrahydro-1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) |
|---|---|
| PubChem CID | 87830426 |
| Molecular Formula | C25H25PZr |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) |
| SMILES | C1=CCC2CC[CH-]C2=C1.Cc1[cH-]c2ccccc2c1Pc1ccccc1.[Zr+2] |
| InChI | InChI=1S/C16H14P.C9H11.Zr/c1-12-11-13-7-5-6-10-15(13)16(12)17-14-8-3-2-4-9-14;1-2-5-9-7-3-6-8(9)4-1;/h2-11,17H,1H3;1-2,4,6,9H,3,5,7H2;/q2*-1;+2 |
| InChIKey | IASVTDVSTMTCCL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|