About 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid
2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid (PubChem CID 87830909) has the molecular formula C11H15N3O4S
and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid |
| PubChem CID | 87830909 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid |
| SMILES | CCc1cn2cc(C(N)=O)ccc2n1.CS(=O)(=O)O |
| InChI | InChI=1S/C10H11N3O.CH4O3S/c1-2-8-6-13-5-7(10(11)14)3-4-9(13)12-8;1-5(2,3)4/h3-6H,2H2,1H3,(H2,11,14);1H3,(H,2,3,4) |
| InChIKey | KWVLTLLJWOFMFO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid?
The IUPAC name of 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid (CID 87830909) is 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid.
What is the SMILES notation for 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid?
The canonical SMILES for 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid is CCc1cn2cc(C(N)=O)ccc2n1.CS(=O)(=O)O.
What is the InChIKey of 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid?
The InChIKey is KWVLTLLJWOFMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O.CH4O3S/c1-2-8-6-13-5-7(10(11)14)3-4-9(13)12-8;1-5(2,3)4/h3-6H,2H2,1H3,(H2,11,14);1H3,(H,2,3,4).
What are the key properties of 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid?
2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid has a molecular weight of 285.32 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylimidazo[1,2-a]pyridine-6-carboxamide;methanesulfonic acid is sourced from PubChem (CID 87830909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).