C24H22ClN3O2 — CID 87830961
N-[(2S,4R)-1-(2-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide (PubChem CID 87830961) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is N-[(2S,4R)-1-(2-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide.
| Compound Name | N-[(2S,4R)-1-(2-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 87830961 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[(2S,4R)-1-(2-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)[C@@H]1C[C@H](C)N(C(=O)c2cccnc2Cl)c2ccccc21 |
| InChI | InChI=1S/C24H22ClN3O2/c1-16-15-22(28(17(2)29)18-9-4-3-5-10-18)19-11-6-7-13-21(19)27(16)24(30)20-12-8-14-26-23(20)25/h3-14,16,22H,15H2,1-2H3/t16-,22+/m0/s1 |
| InChIKey | KCVWVDDNIVAPRT-KSFYIVLOSA-N |
| XLogP | 5.27 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|