About ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide
ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide (PubChem CID 87831052) has the molecular formula C15H21Br2N3O2
and a molecular weight of 435.16 g/mol. Its IUPAC name is ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide.
Molecular Properties
| Compound Name | ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide |
| PubChem CID | 87831052 |
| Molecular Formula | C15H21Br2N3O2 |
| Molecular Weight | 435.16 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide |
| SMILES | CCOC(=O)C[N+]1=C(N)N(c2c(C)cc(C)cc2Br)CC1.[Br-] |
| InChI | InChI=1S/C15H20BrN3O2.BrH/c1-4-21-13(20)9-18-5-6-19(15(18)17)14-11(3)7-10(2)8-12(14)16;/h7-8,17H,4-6,9H2,1-3H3;1H |
| InChIKey | ZGLZEPPMFIOYFZ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 58.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.16 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide?
The IUPAC name of ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide (CID 87831052) is ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide.
What is the SMILES notation for ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide?
The canonical SMILES for ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide is CCOC(=O)C[N+]1=C(N)N(c2c(C)cc(C)cc2Br)CC1.[Br-].
What is the InChIKey of ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide?
The InChIKey is ZGLZEPPMFIOYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3O2.BrH/c1-4-21-13(20)9-18-5-6-19(15(18)17)14-11(3)7-10(2)8-12(14)16;/h7-8,17H,4-6,9H2,1-3H3;1H.
What are the key properties of ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide?
ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide has a molecular weight of 435.16 g/mol, XLogP of -1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-amino-3-(2-bromo-4,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]acetate bromide is sourced from PubChem (CID 87831052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).