C18H25F3N2O2S — CID 87831188
(2S,4R)-N-butyl-N-methyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxamide (PubChem CID 87831188) has the molecular formula C18H25F3N2O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is (2S,4R)-N-butyl-N-methyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S,4R)-N-butyl-N-methyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87831188 |
| Molecular Formula | C18H25F3N2O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (2S,4R)-N-butyl-N-methyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxamide |
| SMILES | CCCCN(C)C(=O)N1C[C@H](S)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H25F3N2O2S/c1-3-4-5-22(2)18(24)23-9-14(26)7-13(23)11-25-10-12-6-16(20)17(21)8-15(12)19/h6,8,13-14,26H,3-5,7,9-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | YFQLOMZNXPRGHI-UONOGXRCSA-N |
| XLogP | 3.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|