C14H19FN4OS — CID 87831394
5-fluoro-2-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyrimidine-4-carbothialdehyde (PubChem CID 87831394) has the molecular formula C14H19FN4OS and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-fluoro-2-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyrimidine-4-carbothialdehyde.
| Compound Name | 5-fluoro-2-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyrimidine-4-carbothialdehyde |
|---|---|
| PubChem CID | 87831394 |
| Molecular Formula | C14H19FN4OS |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-fluoro-2-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyrimidine-4-carbothialdehyde |
| SMILES | OCC1CCC2CN(c3ncc(F)c(C=S)n3)CCN2C1 |
| InChI | InChI=1S/C14H19FN4OS/c15-12-5-16-14(17-13(12)9-21)19-4-3-18-6-10(8-20)1-2-11(18)7-19/h5,9-11,20H,1-4,6-8H2 |
| InChIKey | MXWDINOMRVSNEJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|