About N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide
N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide (PubChem CID 878314) has the molecular formula C20H17ClN2O
and a molecular weight of 336.82 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide |
| PubChem CID | 878314 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H17ClN2O/c21-17-11-12-19(22-14-17)23-20(24)13-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,18H,13H2,(H,22,23,24) |
| InChIKey | LTVWSMZJEOGPIG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide?
The IUPAC name of N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide (CID 878314) is N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide.
What is the SMILES notation for N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide?
The canonical SMILES for N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide is O=C(CC(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cn1.
What is the InChIKey of N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide?
The InChIKey is LTVWSMZJEOGPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O/c21-17-11-12-19(22-14-17)23-20(24)13-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,18H,13H2,(H,22,23,24).
What are the key properties of N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide?
N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide has a molecular weight of 336.82 g/mol, XLogP of 4.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-pyridinyl)-3,3-diphenylpropanamide is sourced from PubChem (CID 878314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).