C17H30N4O5S — CID 87831710
(3R)-6-cyclohexyl-3-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide (PubChem CID 87831710) has the molecular formula C17H30N4O5S and a molecular weight of 402.52 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-3-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide.
| Compound Name | (3R)-6-cyclohexyl-3-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 87831710 |
| Molecular Formula | C17H30N4O5S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (3R)-6-cyclohexyl-3-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide |
| SMILES | O=C(C[C@@H](CCCC1CCCCC1)c1nc(N2CCCS2(O)O)no1)NO |
| InChI | InChI=1S/C17H30N4O5S/c22-15(19-23)12-14(9-4-8-13-6-2-1-3-7-13)16-18-17(20-26-16)21-10-5-11-27(21,24)25/h13-14,23-25H,1-12H2,(H,19,22)/t14-/m1/s1 |
| InChIKey | HHUFNDQWIMKVSO-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|