About 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid
2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid (PubChem CID 87831752) has the molecular formula C17H12ClF6NO4S
and a molecular weight of 475.79 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid |
| PubChem CID | 87831752 |
| Molecular Formula | C17H12ClF6NO4S |
| Molecular Weight | 475.79 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid |
| SMILES | NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.O=S(=O)(O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H5F6NO.C8H7ClO3S/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15;9-8-3-1-2-7(6-8)4-5-13(10,11)12/h1-3H,(H2,16,17);1-6H,(H,10,11,12)/b;5-4+ |
| InChIKey | VIEHGIDEWSXIQE-RCKHEGBHSA-N |
| XLogP | 5.02 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid?
The IUPAC name of 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid (CID 87831752) is 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid.
What is the SMILES notation for 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid?
The canonical SMILES for 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid is NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.O=S(=O)(O)/C=C/c1cccc(Cl)c1.
What is the InChIKey of 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid?
The InChIKey is VIEHGIDEWSXIQE-RCKHEGBHSA-N. The full InChI is InChI=1S/C9H5F6NO.C8H7ClO3S/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15;9-8-3-1-2-7(6-8)4-5-13(10,11)12/h1-3H,(H2,16,17);1-6H,(H,10,11,12)/b;5-4+.
What are the key properties of 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid?
2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid has a molecular weight of 475.79 g/mol, XLogP of 5.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(trifluoromethyl)benzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid is sourced from PubChem (CID 87831752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).