C15H6Cl2N2O2 — CID 87833089
4,5-dichloro-3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylbenzene-1,2-dicarbonitrile (PubChem CID 87833089) has the molecular formula C15H6Cl2N2O2 and a molecular weight of 317.13 g/mol. Its IUPAC name is 4,5-dichloro-3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylbenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-dichloro-3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 87833089 |
| Molecular Formula | C15H6Cl2N2O2 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 4,5-dichloro-3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-6-methylbenzene-1,2-dicarbonitrile |
| SMILES | Cc1c(Cl)c(Cl)c(C2=CC(=O)C=CC2=O)c(C#N)c1C#N |
| InChI | InChI=1S/C15H6Cl2N2O2/c1-7-10(5-18)11(6-19)13(15(17)14(7)16)9-4-8(20)2-3-12(9)21/h2-4H,1H3 |
| InChIKey | CNNYKKXZGHCXHA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|