C12H15F3N4O2S2 — CID 8783346
N-cyclopropyl-N-[5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 8783346) has the molecular formula C12H15F3N4O2S2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 8783346 |
| Molecular Formula | C12H15F3N4O2S2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-cyclopropyl-N-[5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(SCC(=O)NCC(F)(F)F)s1)C1CC1 |
| InChI | InChI=1S/C12H15F3N4O2S2/c1-2-9(21)19(7-3-4-7)10-17-18-11(23-10)22-5-8(20)16-6-12(13,14)15/h7H,2-6H2,1H3,(H,16,20) |
| InChIKey | PTSQGQODYBHLSG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|