C32H35N3O5 — CID 87833733
(2S)-2-cyclohexyl-2-[[4-(4-formylphenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino]acetic acid (PubChem CID 87833733) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[[4-(4-formylphenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[[4-(4-formylphenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 87833733 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[[4-(4-formylphenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino]acetic acid |
| SMILES | Cc1cc(C)c(NC(=O)Nc2cc(-c3ccc(C=O)cc3)ccc2C(=O)N[C@H](C(=O)O)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C32H35N3O5/c1-19-15-20(2)28(21(3)16-19)35-32(40)33-27-17-25(23-11-9-22(18-36)10-12-23)13-14-26(27)30(37)34-29(31(38)39)24-7-5-4-6-8-24/h9-18,24,29H,4-8H2,1-3H3,(H,34,37)(H,38,39)(H2,33,35,40)/t29-/m0/s1 |
| InChIKey | QODDFYYQGFKQCI-LJAQVGFWSA-N |
| XLogP | 6.50 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|