About 1-isocyanoethyl carbamate
1-isocyanoethyl carbamate (PubChem CID 87833960) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 1-isocyanoethyl carbamate.
Molecular Properties
| Compound Name | 1-isocyanoethyl carbamate |
| PubChem CID | 87833960 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 1-isocyanoethyl carbamate |
| SMILES | [C-]#[N+]C(C)OC(N)=O |
| InChI | InChI=1S/C4H6N2O2/c1-3(6-2)8-4(5)7/h3H,1H3,(H2,5,7) |
| InChIKey | ARKMPIQZDAMZGG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 56.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanoethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanoethyl carbamate?
The IUPAC name of 1-isocyanoethyl carbamate (CID 87833960) is 1-isocyanoethyl carbamate.
What is the SMILES notation for 1-isocyanoethyl carbamate?
The canonical SMILES for 1-isocyanoethyl carbamate is [C-]#[N+]C(C)OC(N)=O.
What is the InChIKey of 1-isocyanoethyl carbamate?
The InChIKey is ARKMPIQZDAMZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-3(6-2)8-4(5)7/h3H,1H3,(H2,5,7).
What are the key properties of 1-isocyanoethyl carbamate?
1-isocyanoethyl carbamate has a molecular weight of 114.10 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanoethyl carbamate is sourced from PubChem (CID 87833960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).