C19H16ClF5N2O3S — CID 87833961
6-chloro-1-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine (PubChem CID 87833961) has the molecular formula C19H16ClF5N2O3S and a molecular weight of 482.86 g/mol. Its IUPAC name is 6-chloro-1-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine.
| Compound Name | 6-chloro-1-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine |
|---|---|
| PubChem CID | 87833961 |
| Molecular Formula | C19H16ClF5N2O3S |
| Molecular Weight | 482.86 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 6-chloro-1-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N1CCC(N2COCc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C19H16ClF5N2O3S/c20-11-1-2-13-10(7-11)8-30-9-27(13)12-3-5-26(6-4-12)31(28,29)19-17(24)15(22)14(21)16(23)18(19)25/h1-2,7,12H,3-6,8-9H2 |
| InChIKey | LFHIXULVOMYWTP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|