About CID 87834028
CID 87834028 (PubChem CID 87834028) has the molecular formula C36H45ClF3N4OSSi
and a molecular weight of 702.38 g/mol.
Molecular Properties
| Compound Name | CID 87834028 |
| PubChem CID | 87834028 |
| Molecular Formula | C36H45ClF3N4OSSi |
| Molecular Weight | 702.38 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=S)N2CCN(CCN3CCc4ncccc4C3)C[C@H]2Cc2ccc(Cl)c(C(C)(C)C)c2O[Si](C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H45ClF3N4OSSi/c1-24-18-27(20-28(19-24)36(38,39)40)34(46)44-17-16-43(15-14-42-13-11-31-26(22-42)8-7-12-41-31)23-29(44)21-25-9-10-30(37)32(35(2,3)4)33(25)45-47(5)6/h7-10,12,18-20,29H,11,13-17,21-23H2,1-6H3/t29-/m1/s1 |
| InChIKey | RMLCLQAXHOKMKY-GDLZYMKVSA-N |
| XLogP | 7.95 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 702.38 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 87834028 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87834028?
The IUPAC name of CID 87834028 (CID 87834028) is not available.
What is the SMILES notation for CID 87834028?
The canonical SMILES for CID 87834028 is Cc1cc(C(=S)N2CCN(CCN3CCc4ncccc4C3)C[C@H]2Cc2ccc(Cl)c(C(C)(C)C)c2O[Si](C)C)cc(C(F)(F)F)c1.
What is the InChIKey of CID 87834028?
The InChIKey is RMLCLQAXHOKMKY-GDLZYMKVSA-N. The full InChI is InChI=1S/C36H45ClF3N4OSSi/c1-24-18-27(20-28(19-24)36(38,39)40)34(46)44-17-16-43(15-14-42-13-11-31-26(22-42)8-7-12-41-31)23-29(44)21-25-9-10-30(37)32(35(2,3)4)33(25)45-47(5)6/h7-10,12,18-20,29H,11,13-17,21-23H2,1-6H3/t29-/m1/s1.
What are the key properties of CID 87834028?
CID 87834028 has a molecular weight of 702.38 g/mol, XLogP of 7.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87834028 is sourced from PubChem (CID 87834028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).