C8H5F11O2 — CID 87834231
2,2,3-trifluoro-3-[1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]oxirane (PubChem CID 87834231) has the molecular formula C8H5F11O2 and a molecular weight of 342.10 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-[1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]oxirane.
| Compound Name | 2,2,3-trifluoro-3-[1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]oxirane |
|---|---|
| PubChem CID | 87834231 |
| Molecular Formula | C8H5F11O2 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2,2,3-trifluoro-3-[1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]oxirane |
| SMILES | CC(OC(F)(F)C(F)(F)C(F)(F)F)C(F)C1(F)OC1(F)F |
| InChI | InChI=1S/C8H5F11O2/c1-2(3(9)4(10)7(16,17)21-4)20-8(18,19)5(11,12)6(13,14)15/h2-3H,1H3 |
| InChIKey | YAMZTANZJCTZKB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|