About CID 87834401
CID 87834401 (PubChem CID 87834401) has the molecular formula C15H20AsN4O4S+
and a molecular weight of 427.34 g/mol.
Molecular Properties
| Compound Name | CID 87834401 |
| PubChem CID | 87834401 |
| Molecular Formula | C15H20AsN4O4S+ |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | — |
| SMILES | CCS(=O)(=O)O[N+]1(CC(C)C)C=Nc2c([As])nc3cccnc3c21.O |
| InChI | InChI=1S/C15H18AsN4O3S.H2O/c1-4-24(21,22)23-20(8-10(2)3)9-18-13-14(20)12-11(19-15(13)16)6-5-7-17-12;/h5-7,9-10H,4,8H2,1-3H3;1H2/q+1; |
| InChIKey | RRSIBFBPNRFWCO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 113.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87834401 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87834401?
The IUPAC name of CID 87834401 (CID 87834401) is not available.
What is the SMILES notation for CID 87834401?
The canonical SMILES for CID 87834401 is CCS(=O)(=O)O[N+]1(CC(C)C)C=Nc2c([As])nc3cccnc3c21.O.
What is the InChIKey of CID 87834401?
The InChIKey is RRSIBFBPNRFWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18AsN4O3S.H2O/c1-4-24(21,22)23-20(8-10(2)3)9-18-13-14(20)12-11(19-15(13)16)6-5-7-17-12;/h5-7,9-10H,4,8H2,1-3H3;1H2/q+1;.
What are the key properties of CID 87834401?
CID 87834401 has a molecular weight of 427.34 g/mol, XLogP of 0.52, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87834401 is sourced from PubChem (CID 87834401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).