C14H16F9NO4S — CID 87834606
[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 87834606) has the molecular formula C14H16F9NO4S and a molecular weight of 465.33 g/mol. Its IUPAC name is [2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87834606 |
| Molecular Formula | C14H16F9NO4S |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | [2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F9NO4S/c1-7(2)10(25)28-9-6-4-3-5-8(9)24-29(26,27)14(22,23)12(17,18)11(15,16)13(19,20)21/h8-9,24H,1,3-6H2,2H3 |
| InChIKey | MDZUSRYTBCCNQU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|