About 1-methoxyethylthiourea
1-methoxyethylthiourea (PubChem CID 87834727) has the molecular formula C4H10N2OS
and a molecular weight of 134.20 g/mol. Its IUPAC name is 1-methoxyethylthiourea.
Molecular Properties
| Compound Name | 1-methoxyethylthiourea |
| PubChem CID | 87834727 |
| Molecular Formula | C4H10N2OS |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1-methoxyethylthiourea |
| SMILES | COC(C)NC(N)=S |
| InChI | InChI=1S/C4H10N2OS/c1-3(7-2)6-4(5)8/h3H,1-2H3,(H3,5,6,8) |
| InChIKey | HFCWDOCWWPYAFR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethylthiourea?
The IUPAC name of 1-methoxyethylthiourea (CID 87834727) is 1-methoxyethylthiourea.
What is the SMILES notation for 1-methoxyethylthiourea?
The canonical SMILES for 1-methoxyethylthiourea is COC(C)NC(N)=S.
What is the InChIKey of 1-methoxyethylthiourea?
The InChIKey is HFCWDOCWWPYAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2OS/c1-3(7-2)6-4(5)8/h3H,1-2H3,(H3,5,6,8).
What are the key properties of 1-methoxyethylthiourea?
1-methoxyethylthiourea has a molecular weight of 134.20 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethylthiourea is sourced from PubChem (CID 87834727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).