About 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal (PubChem CID 87834759) has the molecular formula C16H20IrNO6-
and a molecular weight of 514.55 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal.
Molecular Properties
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal |
| PubChem CID | 87834759 |
| Molecular Formula | C16H20IrNO6- |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=[C-]CCC=O.[Ir] |
| InChI | InChI=1S/C12H15NO4.C4H5O2.Ir/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;5-3-1-2-4-6;/h5-6,8-9H,1-4,7H2,(H,16,17);3H,1-2H2;/q;-1; |
| InChIKey | KHWYJGBYMSZZEY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal?
The IUPAC name of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal (CID 87834759) is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal.
What is the SMILES notation for 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal?
The canonical SMILES for 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal is O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=[C-]CCC=O.[Ir].
What is the InChIKey of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal?
The InChIKey is KHWYJGBYMSZZEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4.C4H5O2.Ir/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;5-3-1-2-4-6;/h5-6,8-9H,1-4,7H2,(H,16,17);3H,1-2H2;/q;-1;.
What are the key properties of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal?
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal has a molecular weight of 514.55 g/mol, XLogP of 0.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;iridium;4-oxobutanal is sourced from PubChem (CID 87834759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).