About bis(1-ethylsulfanyloctane);phosphoric acid
bis(1-ethylsulfanyloctane);phosphoric acid (PubChem CID 87835003) has the molecular formula C20H47O4PS2
and a molecular weight of 446.70 g/mol. Its IUPAC name is bis(1-ethylsulfanyloctane);phosphoric acid.
Molecular Properties
| Compound Name | bis(1-ethylsulfanyloctane);phosphoric acid |
| PubChem CID | 87835003 |
| Molecular Formula | C20H47O4PS2 |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | bis(1-ethylsulfanyloctane);phosphoric acid |
| SMILES | CCCCCCCCSCC.CCCCCCCCSCC.O=P(O)(O)O |
| InChI | InChI=1S/2C10H22S.H3O4P/c2*1-3-5-6-7-8-9-10-11-4-2;1-5(2,3)4/h2*3-10H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | VAPOZYXBSKEIBG-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(1-ethylsulfanyloctane);phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-ethylsulfanyloctane);phosphoric acid?
The IUPAC name of bis(1-ethylsulfanyloctane);phosphoric acid (CID 87835003) is bis(1-ethylsulfanyloctane);phosphoric acid.
What is the SMILES notation for bis(1-ethylsulfanyloctane);phosphoric acid?
The canonical SMILES for bis(1-ethylsulfanyloctane);phosphoric acid is CCCCCCCCSCC.CCCCCCCCSCC.O=P(O)(O)O.
What is the InChIKey of bis(1-ethylsulfanyloctane);phosphoric acid?
The InChIKey is VAPOZYXBSKEIBG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H22S.H3O4P/c2*1-3-5-6-7-8-9-10-11-4-2;1-5(2,3)4/h2*3-10H2,1-2H3;(H3,1,2,3,4).
What are the key properties of bis(1-ethylsulfanyloctane);phosphoric acid?
bis(1-ethylsulfanyloctane);phosphoric acid has a molecular weight of 446.70 g/mol, XLogP of 7.27, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-ethylsulfanyloctane);phosphoric acid is sourced from PubChem (CID 87835003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).