C29H25F3N2O3 — CID 87835172
(2,2,2-trifluoroacetyl) 3-cyclohexyl-2-phenyl-1-(pyridin-2-ylmethyl)indole-6-carboxylate (PubChem CID 87835172) has the molecular formula C29H25F3N2O3 and a molecular weight of 506.52 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-cyclohexyl-2-phenyl-1-(pyridin-2-ylmethyl)indole-6-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-cyclohexyl-2-phenyl-1-(pyridin-2-ylmethyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 87835172 |
| Molecular Formula | C29H25F3N2O3 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-cyclohexyl-2-phenyl-1-(pyridin-2-ylmethyl)indole-6-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1ccc2c(C3CCCCC3)c(-c3ccccc3)n(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C29H25F3N2O3/c30-29(31,32)28(36)37-27(35)21-14-15-23-24(17-21)34(18-22-13-7-8-16-33-22)26(20-11-5-2-6-12-20)25(23)19-9-3-1-4-10-19/h2,5-8,11-17,19H,1,3-4,9-10,18H2 |
| InChIKey | SFXWCBHOKGRBDY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|