About 3-N-methylprop-1-ene-1,1,3-triamine
3-N-methylprop-1-ene-1,1,3-triamine (PubChem CID 87835594) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is 3-N-methylprop-1-ene-1,1,3-triamine.
Molecular Properties
| Compound Name | 3-N-methylprop-1-ene-1,1,3-triamine |
| PubChem CID | 87835594 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 3-N-methylprop-1-ene-1,1,3-triamine |
| SMILES | CNCC=C(N)N |
| InChI | InChI=1S/C4H11N3/c1-7-3-2-4(5)6/h2,7H,3,5-6H2,1H3 |
| InChIKey | QQKRKXHRQFPGHB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-methylprop-1-ene-1,1,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methylprop-1-ene-1,1,3-triamine?
The IUPAC name of 3-N-methylprop-1-ene-1,1,3-triamine (CID 87835594) is 3-N-methylprop-1-ene-1,1,3-triamine.
What is the SMILES notation for 3-N-methylprop-1-ene-1,1,3-triamine?
The canonical SMILES for 3-N-methylprop-1-ene-1,1,3-triamine is CNCC=C(N)N.
What is the InChIKey of 3-N-methylprop-1-ene-1,1,3-triamine?
The InChIKey is QQKRKXHRQFPGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3/c1-7-3-2-4(5)6/h2,7H,3,5-6H2,1H3.
What are the key properties of 3-N-methylprop-1-ene-1,1,3-triamine?
3-N-methylprop-1-ene-1,1,3-triamine has a molecular weight of 101.15 g/mol, XLogP of -1.04, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methylprop-1-ene-1,1,3-triamine is sourced from PubChem (CID 87835594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).