About furan-2,5-dione;2-methylidenebutanoic acid
furan-2,5-dione;2-methylidenebutanoic acid (PubChem CID 87835686) has the molecular formula C9H10O5
and a molecular weight of 198.17 g/mol. Its IUPAC name is furan-2,5-dione;2-methylidenebutanoic acid.
Molecular Properties
| Compound Name | furan-2,5-dione;2-methylidenebutanoic acid |
| PubChem CID | 87835686 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | furan-2,5-dione;2-methylidenebutanoic acid |
| SMILES | C=C(CC)C(=O)O.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H8O2.C4H2O3/c1-3-4(2)5(6)7;5-3-1-2-4(6)7-3/h2-3H2,1H3,(H,6,7);1-2H |
| InChIKey | YGBMWGZUJQZJEV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;2-methylidenebutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;2-methylidenebutanoic acid?
The IUPAC name of furan-2,5-dione;2-methylidenebutanoic acid (CID 87835686) is furan-2,5-dione;2-methylidenebutanoic acid.
What is the SMILES notation for furan-2,5-dione;2-methylidenebutanoic acid?
The canonical SMILES for furan-2,5-dione;2-methylidenebutanoic acid is C=C(CC)C(=O)O.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;2-methylidenebutanoic acid?
The InChIKey is YGBMWGZUJQZJEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H2O3/c1-3-4(2)5(6)7;5-3-1-2-4(6)7-3/h2-3H2,1H3,(H,6,7);1-2H.
What are the key properties of furan-2,5-dione;2-methylidenebutanoic acid?
furan-2,5-dione;2-methylidenebutanoic acid has a molecular weight of 198.17 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;2-methylidenebutanoic acid is sourced from PubChem (CID 87835686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).