About methyl-tris(2-octa-2,7-dienoxyethoxy)silane
methyl-tris(2-octa-2,7-dienoxyethoxy)silane (PubChem CID 87835703) has the molecular formula C31H54O6Si
and a molecular weight of 550.85 g/mol. Its IUPAC name is methyl-tris(2-octa-2,7-dienoxyethoxy)silane.
Molecular Properties
| Compound Name | methyl-tris(2-octa-2,7-dienoxyethoxy)silane |
| PubChem CID | 87835703 |
| Molecular Formula | C31H54O6Si |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | methyl-tris(2-octa-2,7-dienoxyethoxy)silane |
| SMILES | C=CCCCC=CCOCCO[Si](C)(OCCOCC=CCCCC=C)OCCOCC=CCCCC=C |
| InChI | InChI=1S/C31H54O6Si/c1-5-8-11-14-17-20-23-32-26-29-35-38(4,36-30-27-33-24-21-18-15-12-9-6-2)37-31-28-34-25-22-19-16-13-10-7-3/h5-7,17-22H,1-3,8-16,23-31H2,4H3 |
| InChIKey | WQDNCXDRFCDPNN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl-tris(2-octa-2,7-dienoxyethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-tris(2-octa-2,7-dienoxyethoxy)silane?
The IUPAC name of methyl-tris(2-octa-2,7-dienoxyethoxy)silane (CID 87835703) is methyl-tris(2-octa-2,7-dienoxyethoxy)silane.
What is the SMILES notation for methyl-tris(2-octa-2,7-dienoxyethoxy)silane?
The canonical SMILES for methyl-tris(2-octa-2,7-dienoxyethoxy)silane is C=CCCCC=CCOCCO[Si](C)(OCCOCC=CCCCC=C)OCCOCC=CCCCC=C.
What is the InChIKey of methyl-tris(2-octa-2,7-dienoxyethoxy)silane?
The InChIKey is WQDNCXDRFCDPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H54O6Si/c1-5-8-11-14-17-20-23-32-26-29-35-38(4,36-30-27-33-24-21-18-15-12-9-6-2)37-31-28-34-25-22-19-16-13-10-7-3/h5-7,17-22H,1-3,8-16,23-31H2,4H3.
What are the key properties of methyl-tris(2-octa-2,7-dienoxyethoxy)silane?
methyl-tris(2-octa-2,7-dienoxyethoxy)silane has a molecular weight of 550.85 g/mol, XLogP of 7.39, 30 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-tris(2-octa-2,7-dienoxyethoxy)silane is sourced from PubChem (CID 87835703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).