About [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol
[4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol (PubChem CID 87835846) has the molecular formula C23H15F6N3S
and a molecular weight of 479.45 g/mol. Its IUPAC name is [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol.
Molecular Properties
| Compound Name | [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol |
| PubChem CID | 87835846 |
| Molecular Formula | C23H15F6N3S |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol |
| SMILES | FC(F)(F)c1ccc(-c2nc(C(S)c3ccccn3)[nH]c2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H15F6N3S/c24-22(25,26)15-8-4-13(5-9-15)18-19(14-6-10-16(11-7-14)23(27,28)29)32-21(31-18)20(33)17-3-1-2-12-30-17/h1-12,20,33H,(H,31,32) |
| InChIKey | ANVJHLITFLTTOD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol?
The IUPAC name of [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol (CID 87835846) is [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol.
What is the SMILES notation for [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol?
The canonical SMILES for [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol is FC(F)(F)c1ccc(-c2nc(C(S)c3ccccn3)[nH]c2-c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol?
The InChIKey is ANVJHLITFLTTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F6N3S/c24-22(25,26)15-8-4-13(5-9-15)18-19(14-6-10-16(11-7-14)23(27,28)29)32-21(31-18)20(33)17-3-1-2-12-30-17/h1-12,20,33H,(H,31,32).
What are the key properties of [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol?
[4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol has a molecular weight of 479.45 g/mol, XLogP of 7.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-bis[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]-pyridin-2-ylmethanethiol is sourced from PubChem (CID 87835846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).