About 3-ethyloct-1-yn-1-ol;ethynol
3-ethyloct-1-yn-1-ol;ethynol (PubChem CID 87836023) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-ethyloct-1-yn-1-ol;ethynol.
Molecular Properties
| Compound Name | 3-ethyloct-1-yn-1-ol;ethynol |
| PubChem CID | 87836023 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 3-ethyloct-1-yn-1-ol;ethynol |
| SMILES | C#CO.CCCCCC(C#CO)CC |
| InChI | InChI=1S/C10H18O.C2H2O/c1-3-5-6-7-10(4-2)8-9-11;1-2-3/h10-11H,3-7H2,1-2H3;1,3H |
| InChIKey | RJSFMWMNLUCQRY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyloct-1-yn-1-ol;ethynol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyloct-1-yn-1-ol;ethynol?
The IUPAC name of 3-ethyloct-1-yn-1-ol;ethynol (CID 87836023) is 3-ethyloct-1-yn-1-ol;ethynol.
What is the SMILES notation for 3-ethyloct-1-yn-1-ol;ethynol?
The canonical SMILES for 3-ethyloct-1-yn-1-ol;ethynol is C#CO.CCCCCC(C#CO)CC.
What is the InChIKey of 3-ethyloct-1-yn-1-ol;ethynol?
The InChIKey is RJSFMWMNLUCQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C2H2O/c1-3-5-6-7-10(4-2)8-9-11;1-2-3/h10-11H,3-7H2,1-2H3;1,3H.
What are the key properties of 3-ethyloct-1-yn-1-ol;ethynol?
3-ethyloct-1-yn-1-ol;ethynol has a molecular weight of 196.29 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyloct-1-yn-1-ol;ethynol is sourced from PubChem (CID 87836023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).