C32H36F3N3O4 — CID 87836068
(2,2,2-trifluoroacetyl) 3-cyclohexyl-1-[2-[2-(1-methylpyrrolidin-3-yl)ethylamino]-2-oxoethyl]-2-phenylindole-6-carboxylate (PubChem CID 87836068) has the molecular formula C32H36F3N3O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-cyclohexyl-1-[2-[2-(1-methylpyrrolidin-3-yl)ethylamino]-2-oxoethyl]-2-phenylindole-6-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-cyclohexyl-1-[2-[2-(1-methylpyrrolidin-3-yl)ethylamino]-2-oxoethyl]-2-phenylindole-6-carboxylate |
|---|---|
| PubChem CID | 87836068 |
| Molecular Formula | C32H36F3N3O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-cyclohexyl-1-[2-[2-(1-methylpyrrolidin-3-yl)ethylamino]-2-oxoethyl]-2-phenylindole-6-carboxylate |
| SMILES | CN1CCC(CCNC(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3ccc(C(=O)OC(=O)C(F)(F)F)cc32)C1 |
| InChI | InChI=1S/C32H36F3N3O4/c1-37-17-15-21(19-37)14-16-36-27(39)20-38-26-18-24(30(40)42-31(41)32(33,34)35)12-13-25(26)28(22-8-4-2-5-9-22)29(38)23-10-6-3-7-11-23/h3,6-7,10-13,18,21-22H,2,4-5,8-9,14-17,19-20H2,1H3,(H,36,39) |
| InChIKey | LUYKNFYFEMKSSU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|