About 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate
2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate (PubChem CID 87836103) has the molecular formula C8H8BF4N2O2-
and a molecular weight of 250.97 g/mol. Its IUPAC name is 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate.
Molecular Properties
| Compound Name | 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate |
| PubChem CID | 87836103 |
| Molecular Formula | C8H8BF4N2O2- |
| Molecular Weight | 250.97 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate |
| SMILES | F[B-](F)(F)F.[N-]=[N+]=C1C=CC(CC(=O)O)C=C1 |
| InChI | InChI=1S/C8H8N2O2.BF4/c9-10-7-3-1-6(2-4-7)5-8(11)12;2-1(3,4)5/h1-4,6H,5H2,(H,11,12);/q;-1 |
| InChIKey | AHZQNQVDIGWWOB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.97 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate?
The IUPAC name of 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate (CID 87836103) is 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate.
What is the SMILES notation for 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate?
The canonical SMILES for 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate is F[B-](F)(F)F.[N-]=[N+]=C1C=CC(CC(=O)O)C=C1.
What is the InChIKey of 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate?
The InChIKey is AHZQNQVDIGWWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.BF4/c9-10-7-3-1-6(2-4-7)5-8(11)12;2-1(3,4)5/h1-4,6H,5H2,(H,11,12);/q;-1.
What are the key properties of 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate?
2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate has a molecular weight of 250.97 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-diazocyclohexa-2,5-dien-1-yl)acetic acid tetrafluoroborate is sourced from PubChem (CID 87836103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).