C30H33BrF3N5O2 — CID 87836254
[4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2-(trifluoromethyl)-1,8-naphthyridin-3-yl]methanone (PubChem CID 87836254) has the molecular formula C30H33BrF3N5O2 and a molecular weight of 632.53 g/mol. Its IUPAC name is [4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2-(trifluoromethyl)-1,8-naphthyridin-3-yl]methanone.
| Compound Name | [4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2-(trifluoromethyl)-1,8-naphthyridin-3-yl]methanone |
|---|---|
| PubChem CID | 87836254 |
| Molecular Formula | C30H33BrF3N5O2 |
| Molecular Weight | 632.53 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | [4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-[2-(trifluoromethyl)-1,8-naphthyridin-3-yl]methanone |
| SMILES | CCO/N=C(\c1ccc(Br)cc1)C1CCN(C2(C)CCN(C(=O)c3cc4cccnc4nc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C30H33BrF3N5O2/c1-3-41-37-25(20-6-8-23(31)9-7-20)21-10-15-39(16-11-21)29(2)12-17-38(18-13-29)28(40)24-19-22-5-4-14-35-27(22)36-26(24)30(32,33)34/h4-9,14,19,21H,3,10-13,15-18H2,1-2H3/b37-25+ |
| InChIKey | COHCPTVKXQGFFQ-AUGOTPMTSA-N |
| XLogP | 6.56 |
| TPSA | 70.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|