C29H36F3N11O2 — CID 87836459
3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxo-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 87836459) has the molecular formula C29H36F3N11O2 and a molecular weight of 627.68 g/mol. Its IUPAC name is 3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxo-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxo-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 87836459 |
| Molecular Formula | C29H36F3N11O2 |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | 3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxo-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)CC(=O)Nc4ccc(C(F)(F)F)cc4)cc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C29H36F3N11O2/c30-29(31,32)17-3-7-22(8-4-17)37-25(45)11-24(44)16-1-5-23(6-2-16)38-26-39-27(42-12-18(33)9-19(34)13-42)41-28(40-26)43-14-20(35)10-21(36)15-43/h1-8,18-21H,9-15,33-36H2,(H,37,45)(H,38,39,40,41)/t18-,19+,20-,21+ |
| InChIKey | KKRFSGRLVRZWGH-FXELSEDVSA-N |
| XLogP | 1.57 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|