C26H35F3N2O6SSi — CID 87836467
triethoxy-[4-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]phenyl]silane;trifluoromethanesulfonate (PubChem CID 87836467) has the molecular formula C26H35F3N2O6SSi and a molecular weight of 588.72 g/mol. Its IUPAC name is triethoxy-[4-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]phenyl]silane;trifluoromethanesulfonate.
| Compound Name | triethoxy-[4-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]phenyl]silane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87836467 |
| Molecular Formula | C26H35F3N2O6SSi |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | triethoxy-[4-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]phenyl]silane;trifluoromethanesulfonate |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(C[n+]2ccn(-c3c(C)cc(C)cc3C)c2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H35N2O3Si.CHF3O3S/c1-7-28-31(29-8-2,30-9-3)24-12-10-23(11-13-24)18-26-14-15-27(19-26)25-21(5)16-20(4)17-22(25)6;2-1(3,4)8(5,6)7/h10-17,19H,7-9,18H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UAAPAYJOKZDKPX-UHFFFAOYSA-M |
| XLogP | 4.05 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|