C25H30F6O8S3 — CID 87836967
3-[4-[3-[1-(2-adamantyl)propan-2-yloxy]-3-oxopropyl]sulfanylphenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 87836967) has the molecular formula C25H30F6O8S3 and a molecular weight of 668.70 g/mol. Its IUPAC name is 3-[4-[3-[1-(2-adamantyl)propan-2-yloxy]-3-oxopropyl]sulfanylphenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-[3-[1-(2-adamantyl)propan-2-yloxy]-3-oxopropyl]sulfanylphenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87836967 |
| Molecular Formula | C25H30F6O8S3 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | 3-[4-[3-[1-(2-adamantyl)propan-2-yloxy]-3-oxopropyl]sulfanylphenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CC(CC1C2CC3CC(C2)CC1C3)OC(=O)CCSc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H30F6O8S3/c1-14(8-21-17-10-15-9-16(12-17)13-18(21)11-15)38-22(32)6-7-40-20-4-2-19(3-5-20)39-42(36,37)25(30,31)23(26,27)24(28,29)41(33,34)35/h2-5,14-18,21H,6-13H2,1H3,(H,33,34,35) |
| InChIKey | QMLHRHDPNSJPQX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|