C10H10O5S — CID 87837888
methyl 3-(3,3-dioxo-2-oxa-3λ6-thiabicyclo[2.2.2]octa-1(6),4,7-trien-5-yl)propanoate (PubChem CID 87837888) has the molecular formula C10H10O5S and a molecular weight of 242.25 g/mol. Its IUPAC name is methyl 3-(3,3-dioxo-2-oxa-3λ6-thiabicyclo[2.2.2]octa-1(6),4,7-trien-5-yl)propanoate.
| Compound Name | methyl 3-(3,3-dioxo-2-oxa-3λ6-thiabicyclo[2.2.2]octa-1(6),4,7-trien-5-yl)propanoate |
|---|---|
| PubChem CID | 87837888 |
| Molecular Formula | C10H10O5S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | methyl 3-(3,3-dioxo-2-oxa-3λ6-thiabicyclo[2.2.2]octa-1(6),4,7-trien-5-yl)propanoate |
| SMILES | COC(=O)CCc1cc2ccc1S(=O)(=O)O2 |
| InChI | InChI=1S/C10H10O5S/c1-14-10(11)5-2-7-6-8-3-4-9(7)16(12,13)15-8/h3-4,6H,2,5H2,1H3 |
| InChIKey | HFEPUPNAODCSAW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|