C11H14F6O4 — CID 87837926
ethyl 3,3,3-trifluoro-2-(3,3,3-trifluoro-2-prop-2-enoxypropoxy)propanoate (PubChem CID 87837926) has the molecular formula C11H14F6O4 and a molecular weight of 324.22 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(3,3,3-trifluoro-2-prop-2-enoxypropoxy)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(3,3,3-trifluoro-2-prop-2-enoxypropoxy)propanoate |
|---|---|
| PubChem CID | 87837926 |
| Molecular Formula | C11H14F6O4 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(3,3,3-trifluoro-2-prop-2-enoxypropoxy)propanoate |
| SMILES | C=CCOC(COC(C(=O)OCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O4/c1-3-5-20-7(10(12,13)14)6-21-8(11(15,16)17)9(18)19-4-2/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | FZAOYOMLHCUTJW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|