C12H15FN2S — CID 87838360
[(1S)-2-cyclopropyl-1-(4-fluorophenyl)ethyl]thiourea (PubChem CID 87838360) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is [(1S)-2-cyclopropyl-1-(4-fluorophenyl)ethyl]thiourea.
| Compound Name | [(1S)-2-cyclopropyl-1-(4-fluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 87838360 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [(1S)-2-cyclopropyl-1-(4-fluorophenyl)ethyl]thiourea |
| SMILES | NC(=S)N[C@@H](CC1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FN2S/c13-10-5-3-9(4-6-10)11(15-12(14)16)7-8-1-2-8/h3-6,8,11H,1-2,7H2,(H3,14,15,16)/t11-/m0/s1 |
| InChIKey | UXWRDBUXDKDHLM-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|