C12H6F16 — CID 87838923
3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodec-1-ene (PubChem CID 87838923) has the molecular formula C12H6F16 and a molecular weight of 454.15 g/mol. Its IUPAC name is 3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodec-1-ene.
| Compound Name | 3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodec-1-ene |
|---|---|
| PubChem CID | 87838923 |
| Molecular Formula | C12H6F16 |
| Molecular Weight | 454.15 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodec-1-ene |
| SMILES | C=CC(F)(C=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F16/c1-3-5(13,4-2)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)28/h3-4H,1-2H2 |
| InChIKey | HPYILZKZQYVLLM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.15 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|