C19H23ClFN7S — CID 87839031
5-(3-chloro-4-fluorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine (PubChem CID 87839031) has the molecular formula C19H23ClFN7S and a molecular weight of 435.96 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 87839031 |
| Molecular Formula | C19H23ClFN7S |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine |
| SMILES | CN1CCN(CCCNc2nc3nc(-c4ccc(F)c(Cl)c4)nc(N)c3s2)CC1 |
| InChI | InChI=1S/C19H23ClFN7S/c1-27-7-9-28(10-8-27)6-2-5-23-19-26-18-15(29-19)16(22)24-17(25-18)12-3-4-14(21)13(20)11-12/h3-4,11H,2,5-10H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | YWEMTZKOAKXZPR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|