C42H58N3O6+ — CID 87839122
1,1,3-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]-1,3,5-triazinan-1-ium-2,4,6-trione (PubChem CID 87839122) has the molecular formula C42H58N3O6+ and a molecular weight of 700.94 g/mol. Its IUPAC name is 1,1,3-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]-1,3,5-triazinan-1-ium-2,4,6-trione.
| Compound Name | 1,1,3-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]-1,3,5-triazinan-1-ium-2,4,6-trione |
|---|---|
| PubChem CID | 87839122 |
| Molecular Formula | C42H58N3O6+ |
| Molecular Weight | 700.94 g/mol |
| Exact Mass | 700.43 |
| IUPAC Name | 1,1,3-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]-1,3,5-triazinan-1-ium-2,4,6-trione |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CN1C(=O)NC(=O)[N+](Cc2c(C)cc(C(C)(C)C)c(O)c2C)(Cc2c(C)cc(C(C)(C)C)c(O)c2C)C1=O |
| InChI | InChI=1S/C42H57N3O6/c1-22-16-31(40(7,8)9)34(46)25(4)28(22)19-44-37(49)43-38(50)45(39(44)51,20-29-23(2)17-32(41(10,11)12)35(47)26(29)5)21-30-24(3)18-33(42(13,14)15)36(48)27(30)6/h16-18H,19-21H2,1-15H3,(H3-,43,46,47,48,49,50)/p+1 |
| InChIKey | WDSOADRNBCQVJN-UHFFFAOYSA-O |
| XLogP | 9.53 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.94 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|