About 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol
4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol (PubChem CID 87839524) has the molecular formula C10H12N4S2
and a molecular weight of 252.37 g/mol. Its IUPAC name is 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol.
Molecular Properties
| Compound Name | 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol |
| PubChem CID | 87839524 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol |
| SMILES | Cc1nc(C)c(S)c(-c2sc(N)nc2C)n1 |
| InChI | InChI=1S/C10H12N4S2/c1-4-8(15)7(14-6(3)12-4)9-5(2)13-10(11)16-9/h15H,1-3H3,(H2,11,13) |
| InChIKey | FSNPOKUFMMBMPZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol?
The IUPAC name of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol (CID 87839524) is 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol.
What is the SMILES notation for 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol?
The canonical SMILES for 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol is Cc1nc(C)c(S)c(-c2sc(N)nc2C)n1.
What is the InChIKey of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol?
The InChIKey is FSNPOKUFMMBMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4S2/c1-4-8(15)7(14-6(3)12-4)9-5(2)13-10(11)16-9/h15H,1-3H3,(H2,11,13).
What are the key properties of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol?
4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol has a molecular weight of 252.37 g/mol, XLogP of 2.40, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,6-dimethylpyrimidine-5-thiol is sourced from PubChem (CID 87839524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).