C27H9Br12N3O4 — CID 87839841
2,3,4-tribromophenol;4,5,6-tris(2,3,4-tribromophenoxy)triazine (PubChem CID 87839841) has the molecular formula C27H9Br12N3O4 and a molecular weight of 1398.23 g/mol. Its IUPAC name is 2,3,4-tribromophenol;4,5,6-tris(2,3,4-tribromophenoxy)triazine.
| Compound Name | 2,3,4-tribromophenol;4,5,6-tris(2,3,4-tribromophenoxy)triazine |
|---|---|
| PubChem CID | 87839841 |
| Molecular Formula | C27H9Br12N3O4 |
| Molecular Weight | 1398.23 g/mol |
| Exact Mass | 1386.08 |
| IUPAC Name | 2,3,4-tribromophenol;4,5,6-tris(2,3,4-tribromophenoxy)triazine |
| SMILES | Brc1ccc(Oc2nnnc(Oc3ccc(Br)c(Br)c3Br)c2Oc2ccc(Br)c(Br)c2Br)c(Br)c1Br.Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C21H6Br9N3O3.C6H3Br3O/c22-7-1-4-10(16(28)13(7)25)34-19-20(35-11-5-2-8(23)14(26)17(11)29)31-33-32-21(19)36-12-6-3-9(24)15(27)18(12)30;7-3-1-2-4(10)6(9)5(3)8/h1-6H;1-2,10H |
| InChIKey | ZIVCDNFKKJFOJZ-UHFFFAOYSA-N |
| XLogP | 15.79 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1398.23 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|