C17H18F3N3O4 — CID 87839975
[(3R)-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrrolidin-3-yl]carbamic acid (PubChem CID 87839975) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is [(3R)-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3R)-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87839975 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [(3R)-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC(=O)N(c2ccc3c(c2)CCN(C(=O)C(F)(F)F)CC3)C1 |
| InChI | InChI=1S/C17H18F3N3O4/c18-17(19,20)15(25)22-5-3-10-1-2-13(7-11(10)4-6-22)23-9-12(8-14(23)24)21-16(26)27/h1-2,7,12,21H,3-6,8-9H2,(H,26,27)/t12-/m1/s1 |
| InChIKey | REKHFKQGKXOAPD-GFCCVEGCSA-N |
| XLogP | 1.55 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |