C14H15F3O2 — CID 87840054
3,3,3-trifluoro-2-hydroxy-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)propanal (PubChem CID 87840054) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)propanal.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)propanal |
|---|---|
| PubChem CID | 87840054 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)propanal |
| SMILES | O=CC(O)(CC1CCCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C14H15F3O2/c15-14(16,17)13(19,9-18)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-2,4,7,9,11,19H,3,5-6,8H2 |
| InChIKey | JXSYZDXPEFOUIC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|