C5H14N6O4 — CID 87840251
2,3-dinitropentane-1,1,1,2-tetramine (PubChem CID 87840251) has the molecular formula C5H14N6O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2,3-dinitropentane-1,1,1,2-tetramine.
| Compound Name | 2,3-dinitropentane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 87840251 |
| Molecular Formula | C5H14N6O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2,3-dinitropentane-1,1,1,2-tetramine |
| SMILES | CCC([N+](=O)[O-])C(N)([N+](=O)[O-])C(N)(N)N |
| InChI | InChI=1S/C5H14N6O4/c1-2-3(10(12)13)4(6,11(14)15)5(7,8)9/h3H,2,6-9H2,1H3 |
| InChIKey | CVLUUBOAWJAQFF-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 190.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|