C15H17F3O2 — CID 87840372
3,3,3-trifluoro-2-hydroxy-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]propanal (PubChem CID 87840372) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]propanal.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]propanal |
|---|---|
| PubChem CID | 87840372 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]propanal |
| SMILES | CC1CCC(CC(O)(C=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C15H17F3O2/c1-10-6-7-11(13-5-3-2-4-12(10)13)8-14(20,9-19)15(16,17)18/h2-5,9-11,20H,6-8H2,1H3 |
| InChIKey | FTQJXHUBOKSUDC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|