About 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione
4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione (PubChem CID 87840511) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione |
| PubChem CID | 87840511 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione |
| SMILES | COC1=C(OC)C(CC(C)N)=CCC1=S |
| InChI | InChI=1S/C11H17NO2S/c1-7(12)6-8-4-5-9(15)11(14-3)10(8)13-2/h4,7H,5-6,12H2,1-3H3 |
| InChIKey | DTCFPPCYUBLGPL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione?
The IUPAC name of 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione (CID 87840511) is 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione?
The canonical SMILES for 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione is COC1=C(OC)C(CC(C)N)=CCC1=S.
What is the InChIKey of 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione?
The InChIKey is DTCFPPCYUBLGPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-7(12)6-8-4-5-9(15)11(14-3)10(8)13-2/h4,7H,5-6,12H2,1-3H3.
What are the key properties of 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione?
4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione has a molecular weight of 227.33 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)-2,3-dimethoxycyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 87840511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).